C18H17F8NO9S — CID 155182282
(2,2-dimethyl-3-nitrooxypropoxy)carbonyloxymethyl 6-(pentafluoro-λ6-sulfanyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylate (PubChem CID 155182282) has the molecular formula C18H17F8NO9S and a molecular weight of 575.38 g/mol. Its IUPAC name is (2,2-dimethyl-3-nitrooxypropoxy)carbonyloxymethyl 6-(pentafluoro-λ6-sulfanyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylate.
| Compound Name | (2,2-dimethyl-3-nitrooxypropoxy)carbonyloxymethyl 6-(pentafluoro-λ6-sulfanyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 155182282 |
| Molecular Formula | C18H17F8NO9S |
| Molecular Weight | 575.38 g/mol |
| Exact Mass | 575.05 |
| IUPAC Name | (2,2-dimethyl-3-nitrooxypropoxy)carbonyloxymethyl 6-(pentafluoro-λ6-sulfanyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
| SMILES | CC(C)(COC(=O)OCOC(=O)C1=Cc2cc(S(F)(F)(F)(F)F)ccc2OC1C(F)(F)F)CO[N+](=O)[O-] |
| InChI | InChI=1S/C18H17F8NO9S/c1-17(2,8-35-27(30)31)7-32-16(29)34-9-33-15(28)12-6-10-5-11(37(22,23,24,25)26)3-4-13(10)36-14(12)18(19,20)21/h3-6,14H,7-9H2,1-2H3 |
| InChIKey | JCFYAYVCWLMZLC-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 123.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.38 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|