C18H19ClF3NO8 — CID 155200311
3-(methoxyamino)oxypropoxycarbonyloxymethyl 6-chloro-8-methyl-2-(trifluoromethyl)-2H-chromene-3-carboxylate (PubChem CID 155200311) has the molecular formula C18H19ClF3NO8 and a molecular weight of 469.80 g/mol. Its IUPAC name is 3-(methoxyamino)oxypropoxycarbonyloxymethyl 6-chloro-8-methyl-2-(trifluoromethyl)-2H-chromene-3-carboxylate.
| Compound Name | 3-(methoxyamino)oxypropoxycarbonyloxymethyl 6-chloro-8-methyl-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 155200311 |
| Molecular Formula | C18H19ClF3NO8 |
| Molecular Weight | 469.80 g/mol |
| Exact Mass | 469.08 |
| IUPAC Name | 3-(methoxyamino)oxypropoxycarbonyloxymethyl 6-chloro-8-methyl-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
| SMILES | CONOCCCOC(=O)OCOC(=O)C1=Cc2cc(Cl)cc(C)c2OC1C(F)(F)F |
| InChI | InChI=1S/C18H19ClF3NO8/c1-10-6-12(19)7-11-8-13(15(18(20,21)22)31-14(10)11)16(24)28-9-29-17(25)27-4-3-5-30-23-26-2/h6-8,15,23H,3-5,9H2,1-2H3 |
| InChIKey | CQCULOOKIIUCQA-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.80 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|