C16H15BrF3N3O5 — CID 118238504
azetidin-1-yl-[[6-bromo-8-(trideuteriomethyl)-2-(trifluoromethyl)-2H-chromene-3-carbonyl]oxymethoxyimino]-oxidoazanium (PubChem CID 118238504) has the molecular formula C16H15BrF3N3O5 and a molecular weight of 469.23 g/mol. Its IUPAC name is azetidin-1-yl-[[6-bromo-8-(trideuteriomethyl)-2-(trifluoromethyl)-2H-chromene-3-carbonyl]oxymethoxyimino]-oxidoazanium.
| Compound Name | azetidin-1-yl-[[6-bromo-8-(trideuteriomethyl)-2-(trifluoromethyl)-2H-chromene-3-carbonyl]oxymethoxyimino]-oxidoazanium |
|---|---|
| PubChem CID | 118238504 |
| Molecular Formula | C16H15BrF3N3O5 |
| Molecular Weight | 469.23 g/mol |
| Exact Mass | 468.03 |
| IUPAC Name | azetidin-1-yl-[[6-bromo-8-(trideuteriomethyl)-2-(trifluoromethyl)-2H-chromene-3-carbonyl]oxymethoxyimino]-oxidoazanium |
| SMILES | [2H]C([2H])([2H])c1cc(Br)cc2c1OC(C(F)(F)F)C(C(=O)OCON=[N+]([O-])N1CCC1)=C2 |
| InChI | InChI=1S/C16H15BrF3N3O5/c1-9-5-11(17)6-10-7-12(14(16(18,19)20)28-13(9)10)15(24)26-8-27-21-23(25)22-3-2-4-22/h5-7,14H,2-4,8H2,1H3/i1D3 |
| InChIKey | HFFXVKNRZDGTRI-FIBGUPNXSA-N |
| XLogP | 3.48 |
| TPSA | 86.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.23 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|