C15H13BrF3N2O9+ — CID 149377247
[2-[(2S)-6-bromo-8-methyl-2-(trifluoromethyl)-2H-chromene-3-carbonyl]oxy-3-nitrooxypropoxy]-hydroxy-oxoazanium (PubChem CID 149377247) has the molecular formula C15H13BrF3N2O9+ and a molecular weight of 502.17 g/mol. Its IUPAC name is [2-[(2S)-6-bromo-8-methyl-2-(trifluoromethyl)-2H-chromene-3-carbonyl]oxy-3-nitrooxypropoxy]-hydroxy-oxoazanium.
| Compound Name | [2-[(2S)-6-bromo-8-methyl-2-(trifluoromethyl)-2H-chromene-3-carbonyl]oxy-3-nitrooxypropoxy]-hydroxy-oxoazanium |
|---|---|
| PubChem CID | 149377247 |
| Molecular Formula | C15H13BrF3N2O9+ |
| Molecular Weight | 502.17 g/mol |
| Exact Mass | 500.98 |
| IUPAC Name | [2-[(2S)-6-bromo-8-methyl-2-(trifluoromethyl)-2H-chromene-3-carbonyl]oxy-3-nitrooxypropoxy]-hydroxy-oxoazanium |
| SMILES | Cc1cc(Br)cc2c1O[C@H](C(F)(F)F)C(C(=O)OC(CO[N+](=O)[O-])CO[N+](=O)O)=C2 |
| InChI | InChI=1S/C15H13BrF3N2O9/c1-7-2-9(16)3-8-4-11(13(15(17,18)19)30-12(7)8)14(22)29-10(5-27-20(23)24)6-28-21(25)26/h2-4,10,13H,5-6H2,1H3,(H,23,24)/q+1/t10?,13-/m0/s1 |
| InChIKey | YKYVXSQSGYCDHK-HQVZTVAUSA-N |
| XLogP | 2.68 |
| TPSA | 137.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.17 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|