C16H13BrF3NO8 — CID 122699845
(1-acetyloxy-2-nitrooxyethyl) 6-bromo-8-methyl-2-(trifluoromethyl)-2H-chromene-3-carboxylate (PubChem CID 122699845) has the molecular formula C16H13BrF3NO8 and a molecular weight of 484.18 g/mol. Its IUPAC name is (1-acetyloxy-2-nitrooxyethyl) 6-bromo-8-methyl-2-(trifluoromethyl)-2H-chromene-3-carboxylate.
| Compound Name | (1-acetyloxy-2-nitrooxyethyl) 6-bromo-8-methyl-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 122699845 |
| Molecular Formula | C16H13BrF3NO8 |
| Molecular Weight | 484.18 g/mol |
| Exact Mass | 482.98 |
| IUPAC Name | (1-acetyloxy-2-nitrooxyethyl) 6-bromo-8-methyl-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
| SMILES | CC(=O)OC(CO[N+](=O)[O-])OC(=O)C1=Cc2cc(Br)cc(C)c2OC1C(F)(F)F |
| InChI | InChI=1S/C16H13BrF3NO8/c1-7-3-10(17)4-9-5-11(14(16(18,19)20)29-13(7)9)15(23)28-12(27-8(2)22)6-26-21(24)25/h3-5,12,14H,6H2,1-2H3 |
| InChIKey | LFRKRQMZJCPKPZ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 114.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.18 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|