C18H19Cl2F3N4O5 — CID 118222410
methyl 5-[[amino-(hydroxyamino)methylidene]amino]-2-[[(2S)-6,8-dichloro-2-(trifluoromethyl)-2H-chromene-3-carbonyl]amino]pentanoate (PubChem CID 118222410) has the molecular formula C18H19Cl2F3N4O5 and a molecular weight of 499.27 g/mol. Its IUPAC name is methyl 5-[[amino-(hydroxyamino)methylidene]amino]-2-[[(2S)-6,8-dichloro-2-(trifluoromethyl)-2H-chromene-3-carbonyl]amino]pentanoate.
| Compound Name | methyl 5-[[amino-(hydroxyamino)methylidene]amino]-2-[[(2S)-6,8-dichloro-2-(trifluoromethyl)-2H-chromene-3-carbonyl]amino]pentanoate |
|---|---|
| PubChem CID | 118222410 |
| Molecular Formula | C18H19Cl2F3N4O5 |
| Molecular Weight | 499.27 g/mol |
| Exact Mass | 498.07 |
| IUPAC Name | methyl 5-[[amino-(hydroxyamino)methylidene]amino]-2-[[(2S)-6,8-dichloro-2-(trifluoromethyl)-2H-chromene-3-carbonyl]amino]pentanoate |
| SMILES | COC(=O)C(CCC/N=C(\N)NO)NC(=O)C1=Cc2cc(Cl)cc(Cl)c2O[C@@H]1C(F)(F)F |
| InChI | InChI=1S/C18H19Cl2F3N4O5/c1-31-16(29)12(3-2-4-25-17(24)27-30)26-15(28)10-6-8-5-9(19)7-11(20)13(8)32-14(10)18(21,22)23/h5-7,12,14,30H,2-4H2,1H3,(H,26,28)(H3,24,25,27)/t12?,14-/m0/s1 |
| InChIKey | BACZEMHIHZHRIH-PYMCNQPYSA-N |
| XLogP | 2.43 |
| TPSA | 135.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.27 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|