C20H24BrF3N4O5 — CID 154298051
ethyl (2S)-5-[[amino-(hydroxyamino)methylidene]amino]-2-[[(2S)-6-bromo-8-methyl-2-(trifluoromethyl)-2H-chromene-3-carbonyl]amino]pentanoate (PubChem CID 154298051) has the molecular formula C20H24BrF3N4O5 and a molecular weight of 537.33 g/mol. Its IUPAC name is ethyl (2S)-5-[[amino-(hydroxyamino)methylidene]amino]-2-[[(2S)-6-bromo-8-methyl-2-(trifluoromethyl)-2H-chromene-3-carbonyl]amino]pentanoate.
| Compound Name | ethyl (2S)-5-[[amino-(hydroxyamino)methylidene]amino]-2-[[(2S)-6-bromo-8-methyl-2-(trifluoromethyl)-2H-chromene-3-carbonyl]amino]pentanoate |
|---|---|
| PubChem CID | 154298051 |
| Molecular Formula | C20H24BrF3N4O5 |
| Molecular Weight | 537.33 g/mol |
| Exact Mass | 536.09 |
| IUPAC Name | ethyl (2S)-5-[[amino-(hydroxyamino)methylidene]amino]-2-[[(2S)-6-bromo-8-methyl-2-(trifluoromethyl)-2H-chromene-3-carbonyl]amino]pentanoate |
| SMILES | CCOC(=O)[C@H](CCC/N=C(\N)NO)NC(=O)C1=Cc2cc(Br)cc(C)c2O[C@@H]1C(F)(F)F |
| InChI | InChI=1S/C20H24BrF3N4O5/c1-3-32-18(30)14(5-4-6-26-19(25)28-31)27-17(29)13-9-11-8-12(21)7-10(2)15(11)33-16(13)20(22,23)24/h7-9,14,16,31H,3-6H2,1-2H3,(H,27,29)(H3,25,26,28)/t14-,16-/m0/s1 |
| InChIKey | TWLGUYWNBMTWJN-HOCLYGCPSA-N |
| XLogP | 2.59 |
| TPSA | 135.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.33 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|