C25H33F3N4O6 — CID 118229754
3-[(2S)-2-acetamido-5-(diaminomethylideneamino)pentanoyl]oxypropyl (2S)-8-ethyl-6-methyl-2-(trifluoromethyl)-2H-chromene-3-carboxylate (PubChem CID 118229754) has the molecular formula C25H33F3N4O6 and a molecular weight of 542.56 g/mol. Its IUPAC name is 3-[(2S)-2-acetamido-5-(diaminomethylideneamino)pentanoyl]oxypropyl (2S)-8-ethyl-6-methyl-2-(trifluoromethyl)-2H-chromene-3-carboxylate.
| Compound Name | 3-[(2S)-2-acetamido-5-(diaminomethylideneamino)pentanoyl]oxypropyl (2S)-8-ethyl-6-methyl-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 118229754 |
| Molecular Formula | C25H33F3N4O6 |
| Molecular Weight | 542.56 g/mol |
| Exact Mass | 542.24 |
| IUPAC Name | 3-[(2S)-2-acetamido-5-(diaminomethylideneamino)pentanoyl]oxypropyl (2S)-8-ethyl-6-methyl-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
| SMILES | CCc1cc(C)cc2c1O[C@H](C(F)(F)F)C(C(=O)OCCCOC(=O)[C@H](CCCN=C(N)N)NC(C)=O)=C2 |
| InChI | InChI=1S/C25H33F3N4O6/c1-4-16-11-14(2)12-17-13-18(21(25(26,27)28)38-20(16)17)22(34)36-9-6-10-37-23(35)19(32-15(3)33)7-5-8-31-24(29)30/h11-13,19,21H,4-10H2,1-3H3,(H,32,33)(H4,29,30,31)/t19-,21-/m0/s1 |
| InChIKey | JEDLAJPZSVGHCY-FPOVZHCZSA-N |
| XLogP | 2.30 |
| TPSA | 155.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.56 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|