C18H20ClF3N4O5 — CID 154357608
(2S)-5-[[amino-(hydroxyamino)methylidene]amino]-2-[[(2S)-6-chloro-8-methyl-2-(trifluoromethyl)-2H-chromene-3-carbonyl]amino]pentanoic acid (PubChem CID 154357608) has the molecular formula C18H20ClF3N4O5 and a molecular weight of 464.83 g/mol. Its IUPAC name is (2S)-5-[[amino-(hydroxyamino)methylidene]amino]-2-[[(2S)-6-chloro-8-methyl-2-(trifluoromethyl)-2H-chromene-3-carbonyl]amino]pentanoic acid.
| Compound Name | (2S)-5-[[amino-(hydroxyamino)methylidene]amino]-2-[[(2S)-6-chloro-8-methyl-2-(trifluoromethyl)-2H-chromene-3-carbonyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 154357608 |
| Molecular Formula | C18H20ClF3N4O5 |
| Molecular Weight | 464.83 g/mol |
| Exact Mass | 464.11 |
| IUPAC Name | (2S)-5-[[amino-(hydroxyamino)methylidene]amino]-2-[[(2S)-6-chloro-8-methyl-2-(trifluoromethyl)-2H-chromene-3-carbonyl]amino]pentanoic acid |
| SMILES | Cc1cc(Cl)cc2c1O[C@H](C(F)(F)F)C(C(=O)N[C@@H](CCC/N=C(\N)NO)C(=O)O)=C2 |
| InChI | InChI=1S/C18H20ClF3N4O5/c1-8-5-10(19)6-9-7-11(14(18(20,21)22)31-13(8)9)15(27)25-12(16(28)29)3-2-4-24-17(23)26-30/h5-7,12,14,30H,2-4H2,1H3,(H,25,27)(H,28,29)(H3,23,24,26)/t12-,14-/m0/s1 |
| InChIKey | WYKDMQSNFPYEJI-JSGCOSHPSA-N |
| XLogP | 2.00 |
| TPSA | 146.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.83 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|