C19H22BrF3N4O5 — CID 118222227
6-[[amino-(hydroxyamino)methylidene]amino]-2-[[(2S)-6-bromo-8-methyl-2-(trifluoromethyl)-2H-chromene-3-carbonyl]amino]hexanoic acid (PubChem CID 118222227) has the molecular formula C19H22BrF3N4O5 and a molecular weight of 523.31 g/mol. Its IUPAC name is 6-[[amino-(hydroxyamino)methylidene]amino]-2-[[(2S)-6-bromo-8-methyl-2-(trifluoromethyl)-2H-chromene-3-carbonyl]amino]hexanoic acid.
| Compound Name | 6-[[amino-(hydroxyamino)methylidene]amino]-2-[[(2S)-6-bromo-8-methyl-2-(trifluoromethyl)-2H-chromene-3-carbonyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 118222227 |
| Molecular Formula | C19H22BrF3N4O5 |
| Molecular Weight | 523.31 g/mol |
| Exact Mass | 522.07 |
| IUPAC Name | 6-[[amino-(hydroxyamino)methylidene]amino]-2-[[(2S)-6-bromo-8-methyl-2-(trifluoromethyl)-2H-chromene-3-carbonyl]amino]hexanoic acid |
| SMILES | Cc1cc(Br)cc2c1O[C@H](C(F)(F)F)C(C(=O)NC(CCCC/N=C(\N)NO)C(=O)O)=C2 |
| InChI | InChI=1S/C19H22BrF3N4O5/c1-9-6-11(20)7-10-8-12(15(19(21,22)23)32-14(9)10)16(28)26-13(17(29)30)4-2-3-5-25-18(24)27-31/h6-8,13,15,31H,2-5H2,1H3,(H,26,28)(H,29,30)(H3,24,25,27)/t13?,15-/m0/s1 |
| InChIKey | YIIADXATTNRVCW-WUJWULDRSA-N |
| XLogP | 2.50 |
| TPSA | 146.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.31 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|