C18H19Cl2F3N4O5 — CID 118222376
6-[[amino-(hydroxyamino)methylidene]amino]-2-[[(2S)-6,8-dichloro-2-(trifluoromethyl)-2H-chromene-3-carbonyl]amino]hexanoic acid (PubChem CID 118222376) has the molecular formula C18H19Cl2F3N4O5 and a molecular weight of 499.27 g/mol. Its IUPAC name is 6-[[amino-(hydroxyamino)methylidene]amino]-2-[[(2S)-6,8-dichloro-2-(trifluoromethyl)-2H-chromene-3-carbonyl]amino]hexanoic acid.
| Compound Name | 6-[[amino-(hydroxyamino)methylidene]amino]-2-[[(2S)-6,8-dichloro-2-(trifluoromethyl)-2H-chromene-3-carbonyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 118222376 |
| Molecular Formula | C18H19Cl2F3N4O5 |
| Molecular Weight | 499.27 g/mol |
| Exact Mass | 498.07 |
| IUPAC Name | 6-[[amino-(hydroxyamino)methylidene]amino]-2-[[(2S)-6,8-dichloro-2-(trifluoromethyl)-2H-chromene-3-carbonyl]amino]hexanoic acid |
| SMILES | N/C(=N\CCCCC(NC(=O)C1=Cc2cc(Cl)cc(Cl)c2O[C@@H]1C(F)(F)F)C(=O)O)NO |
| InChI | InChI=1S/C18H19Cl2F3N4O5/c19-9-5-8-6-10(14(18(21,22)23)32-13(8)11(20)7-9)15(28)26-12(16(29)30)3-1-2-4-25-17(24)27-31/h5-7,12,14,31H,1-4H2,(H,26,28)(H,29,30)(H3,24,25,27)/t12?,14-/m0/s1 |
| InChIKey | CMSFHENZHCNJSR-PYMCNQPYSA-N |
| XLogP | 2.73 |
| TPSA | 146.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.27 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|