C14H14ClF3O3 — CID 143004415
7-tert-butyl-6-chloro-2-fluoro-2H-chromene-3-carboxylic acid;molecular fluorine (PubChem CID 143004415) has the molecular formula C14H14ClF3O3 and a molecular weight of 322.71 g/mol. Its IUPAC name is 7-tert-butyl-6-chloro-2-fluoro-2H-chromene-3-carboxylic acid;molecular fluorine.
| Compound Name | 7-tert-butyl-6-chloro-2-fluoro-2H-chromene-3-carboxylic acid;molecular fluorine |
|---|---|
| PubChem CID | 143004415 |
| Molecular Formula | C14H14ClF3O3 |
| Molecular Weight | 322.71 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | 7-tert-butyl-6-chloro-2-fluoro-2H-chromene-3-carboxylic acid;molecular fluorine |
| SMILES | CC(C)(C)c1cc2c(cc1Cl)C=C(C(=O)O)C(F)O2.FF |
| InChI | InChI=1S/C14H14ClFO3.F2/c1-14(2,3)9-6-11-7(5-10(9)15)4-8(13(17)18)12(16)19-11;1-2/h4-6,12H,1-3H3,(H,17,18); |
| InChIKey | SUKDYWWVJUBHTI-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.71 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |