About 7-tert-butyl-6-chloro-2-fluoro-2H-chromene-3-carboxylic acid;molecular fluorine
7-tert-butyl-6-chloro-2-fluoro-2H-chromene-3-carboxylic acid;molecular fluorine (PubChem CID 143004415) has the molecular formula C14H14ClF3O3
and a molecular weight of 322.71 g/mol. Its IUPAC name is 7-tert-butyl-6-chloro-2-fluoro-2H-chromene-3-carboxylic acid;molecular fluorine.
Molecular Properties
| Compound Name | 7-tert-butyl-6-chloro-2-fluoro-2H-chromene-3-carboxylic acid;molecular fluorine |
| PubChem CID | 143004415 |
| Molecular Formula | C14H14ClF3O3 |
| Molecular Weight | 322.71 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | 7-tert-butyl-6-chloro-2-fluoro-2H-chromene-3-carboxylic acid;molecular fluorine |
| SMILES | CC(C)(C)c1cc2c(cc1Cl)C=C(C(=O)O)C(F)O2.FF |
| InChI | InChI=1S/C14H14ClFO3.F2/c1-14(2,3)9-6-11-7(5-10(9)15)4-8(13(17)18)12(16)19-11;1-2/h4-6,12H,1-3H3,(H,17,18); |
| InChIKey | SUKDYWWVJUBHTI-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.71 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-tert-butyl-6-chloro-2-fluoro-2H-chromene-3-carboxylic acid;molecular fluorine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-tert-butyl-6-chloro-2-fluoro-2H-chromene-3-carboxylic acid;molecular fluorine?
The IUPAC name of 7-tert-butyl-6-chloro-2-fluoro-2H-chromene-3-carboxylic acid;molecular fluorine (CID 143004415) is 7-tert-butyl-6-chloro-2-fluoro-2H-chromene-3-carboxylic acid;molecular fluorine.
What is the SMILES notation for 7-tert-butyl-6-chloro-2-fluoro-2H-chromene-3-carboxylic acid;molecular fluorine?
The canonical SMILES for 7-tert-butyl-6-chloro-2-fluoro-2H-chromene-3-carboxylic acid;molecular fluorine is CC(C)(C)c1cc2c(cc1Cl)C=C(C(=O)O)C(F)O2.FF.
What is the InChIKey of 7-tert-butyl-6-chloro-2-fluoro-2H-chromene-3-carboxylic acid;molecular fluorine?
The InChIKey is SUKDYWWVJUBHTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14ClFO3.F2/c1-14(2,3)9-6-11-7(5-10(9)15)4-8(13(17)18)12(16)19-11;1-2/h4-6,12H,1-3H3,(H,17,18);.
What are the key properties of 7-tert-butyl-6-chloro-2-fluoro-2H-chromene-3-carboxylic acid;molecular fluorine?
7-tert-butyl-6-chloro-2-fluoro-2H-chromene-3-carboxylic acid;molecular fluorine has a molecular weight of 322.71 g/mol, XLogP of 4.63, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-tert-butyl-6-chloro-2-fluoro-2H-chromene-3-carboxylic acid;molecular fluorine is sourced from PubChem (CID 143004415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).