C12H10Cl2F2O3 — CID 142190519
6,8-dichloro-2-fluoro-2H-chromene-3-carboxylic acid;fluoroethane (PubChem CID 142190519) has the molecular formula C12H10Cl2F2O3 and a molecular weight of 311.11 g/mol. Its IUPAC name is 6,8-dichloro-2-fluoro-2H-chromene-3-carboxylic acid;fluoroethane.
| Compound Name | 6,8-dichloro-2-fluoro-2H-chromene-3-carboxylic acid;fluoroethane |
|---|---|
| PubChem CID | 142190519 |
| Molecular Formula | C12H10Cl2F2O3 |
| Molecular Weight | 311.11 g/mol |
| Exact Mass | 310.00 |
| IUPAC Name | 6,8-dichloro-2-fluoro-2H-chromene-3-carboxylic acid;fluoroethane |
| SMILES | CCF.O=C(O)C1=Cc2cc(Cl)cc(Cl)c2OC1F |
| InChI | InChI=1S/C10H5Cl2FO3.C2H5F/c11-5-1-4-2-6(10(14)15)9(13)16-8(4)7(12)3-5;1-2-3/h1-3,9H,(H,14,15);2H2,1H3 |
| InChIKey | ZZZPNIGFRAGILF-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.11 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |