C14H15ClF2O3 — CID 142913088
8-chloro-2-(1-fluoroethyl)-6-methyl-2H-chromene-3-carboxylic acid;fluoromethane (PubChem CID 142913088) has the molecular formula C14H15ClF2O3 and a molecular weight of 304.72 g/mol. Its IUPAC name is 8-chloro-2-(1-fluoroethyl)-6-methyl-2H-chromene-3-carboxylic acid;fluoromethane.
| Compound Name | 8-chloro-2-(1-fluoroethyl)-6-methyl-2H-chromene-3-carboxylic acid;fluoromethane |
|---|---|
| PubChem CID | 142913088 |
| Molecular Formula | C14H15ClF2O3 |
| Molecular Weight | 304.72 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | 8-chloro-2-(1-fluoroethyl)-6-methyl-2H-chromene-3-carboxylic acid;fluoromethane |
| SMILES | CF.Cc1cc(Cl)c2c(c1)C=C(C(=O)O)C(C(C)F)O2 |
| InChI | InChI=1S/C13H12ClFO3.CH3F/c1-6-3-8-5-9(13(16)17)11(7(2)15)18-12(8)10(14)4-6;1-2/h3-5,7,11H,1-2H3,(H,16,17);1H3 |
| InChIKey | RKCPJGXKJPMKPK-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.72 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |