C22H23F3O4 — CID 142920501
2-(difluoromethyl)-6-(2-phenylacetyl)-2H-chromene-3-carboxylic acid;ethane;fluoromethane (PubChem CID 142920501) has the molecular formula C22H23F3O4 and a molecular weight of 408.42 g/mol. Its IUPAC name is 2-(difluoromethyl)-6-(2-phenylacetyl)-2H-chromene-3-carboxylic acid;ethane;fluoromethane.
| Compound Name | 2-(difluoromethyl)-6-(2-phenylacetyl)-2H-chromene-3-carboxylic acid;ethane;fluoromethane |
|---|---|
| PubChem CID | 142920501 |
| Molecular Formula | C22H23F3O4 |
| Molecular Weight | 408.42 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | 2-(difluoromethyl)-6-(2-phenylacetyl)-2H-chromene-3-carboxylic acid;ethane;fluoromethane |
| SMILES | CC.CF.O=C(O)C1=Cc2cc(C(=O)Cc3ccccc3)ccc2OC1C(F)F |
| InChI | InChI=1S/C19H14F2O4.C2H6.CH3F/c20-18(21)17-14(19(23)24)10-13-9-12(6-7-16(13)25-17)15(22)8-11-4-2-1-3-5-11;2*1-2/h1-7,9-10,17-18H,8H2,(H,23,24);1-2H3;1H3 |
| InChIKey | GIGYYEJFJILOKK-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.42 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |