About 2-(difluoromethyl)-6-(2-phenylacetyl)-2H-chromene-3-carboxylic acid;ethane;fluoromethane
2-(difluoromethyl)-6-(2-phenylacetyl)-2H-chromene-3-carboxylic acid;ethane;fluoromethane (PubChem CID 142920501) has the molecular formula C22H23F3O4
and a molecular weight of 408.42 g/mol. Its IUPAC name is 2-(difluoromethyl)-6-(2-phenylacetyl)-2H-chromene-3-carboxylic acid;ethane;fluoromethane.
Molecular Properties
| Compound Name | 2-(difluoromethyl)-6-(2-phenylacetyl)-2H-chromene-3-carboxylic acid;ethane;fluoromethane |
| PubChem CID | 142920501 |
| Molecular Formula | C22H23F3O4 |
| Molecular Weight | 408.42 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | 2-(difluoromethyl)-6-(2-phenylacetyl)-2H-chromene-3-carboxylic acid;ethane;fluoromethane |
| SMILES | CC.CF.O=C(O)C1=Cc2cc(C(=O)Cc3ccccc3)ccc2OC1C(F)F |
| InChI | InChI=1S/C19H14F2O4.C2H6.CH3F/c20-18(21)17-14(19(23)24)10-13-9-12(6-7-16(13)25-17)15(22)8-11-4-2-1-3-5-11;2*1-2/h1-7,9-10,17-18H,8H2,(H,23,24);1-2H3;1H3 |
| InChIKey | GIGYYEJFJILOKK-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 408.42 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(difluoromethyl)-6-(2-phenylacetyl)-2H-chromene-3-carboxylic acid;ethane;fluoromethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(difluoromethyl)-6-(2-phenylacetyl)-2H-chromene-3-carboxylic acid;ethane;fluoromethane?
The IUPAC name of 2-(difluoromethyl)-6-(2-phenylacetyl)-2H-chromene-3-carboxylic acid;ethane;fluoromethane (CID 142920501) is 2-(difluoromethyl)-6-(2-phenylacetyl)-2H-chromene-3-carboxylic acid;ethane;fluoromethane.
What is the SMILES notation for 2-(difluoromethyl)-6-(2-phenylacetyl)-2H-chromene-3-carboxylic acid;ethane;fluoromethane?
The canonical SMILES for 2-(difluoromethyl)-6-(2-phenylacetyl)-2H-chromene-3-carboxylic acid;ethane;fluoromethane is CC.CF.O=C(O)C1=Cc2cc(C(=O)Cc3ccccc3)ccc2OC1C(F)F.
What is the InChIKey of 2-(difluoromethyl)-6-(2-phenylacetyl)-2H-chromene-3-carboxylic acid;ethane;fluoromethane?
The InChIKey is GIGYYEJFJILOKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14F2O4.C2H6.CH3F/c20-18(21)17-14(19(23)24)10-13-9-12(6-7-16(13)25-17)15(22)8-11-4-2-1-3-5-11;2*1-2/h1-7,9-10,17-18H,8H2,(H,23,24);1-2H3;1H3.
What are the key properties of 2-(difluoromethyl)-6-(2-phenylacetyl)-2H-chromene-3-carboxylic acid;ethane;fluoromethane?
2-(difluoromethyl)-6-(2-phenylacetyl)-2H-chromene-3-carboxylic acid;ethane;fluoromethane has a molecular weight of 408.42 g/mol, XLogP of 5.22, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(difluoromethyl)-6-(2-phenylacetyl)-2H-chromene-3-carboxylic acid;ethane;fluoromethane is sourced from PubChem (CID 142920501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).