C20H20ClFO3 — CID 142920549
6-chloro-2-(1-fluoroethyl)-7-phenyl-2H-chromene-3-carboxylic acid;ethane (PubChem CID 142920549) has the molecular formula C20H20ClFO3 and a molecular weight of 362.83 g/mol. Its IUPAC name is 6-chloro-2-(1-fluoroethyl)-7-phenyl-2H-chromene-3-carboxylic acid;ethane.
| Compound Name | 6-chloro-2-(1-fluoroethyl)-7-phenyl-2H-chromene-3-carboxylic acid;ethane |
|---|---|
| PubChem CID | 142920549 |
| Molecular Formula | C20H20ClFO3 |
| Molecular Weight | 362.83 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | 6-chloro-2-(1-fluoroethyl)-7-phenyl-2H-chromene-3-carboxylic acid;ethane |
| SMILES | CC.CC(F)C1Oc2cc(-c3ccccc3)c(Cl)cc2C=C1C(=O)O |
| InChI | InChI=1S/C18H14ClFO3.C2H6/c1-10(20)17-14(18(21)22)7-12-8-15(19)13(9-16(12)23-17)11-5-3-2-4-6-11;1-2/h2-10,17H,1H3,(H,21,22);1-2H3 |
| InChIKey | ZLZVIGBDZFQDRF-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.83 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |