C19H14F2O4 — CID 142920502
2-(difluoromethyl)-6-(2-phenylacetyl)-2H-chromene-3-carboxylic acid (PubChem CID 142920502) has the molecular formula C19H14F2O4 and a molecular weight of 344.31 g/mol. Its IUPAC name is 2-(difluoromethyl)-6-(2-phenylacetyl)-2H-chromene-3-carboxylic acid.
| Compound Name | 2-(difluoromethyl)-6-(2-phenylacetyl)-2H-chromene-3-carboxylic acid |
|---|---|
| PubChem CID | 142920502 |
| Molecular Formula | C19H14F2O4 |
| Molecular Weight | 344.31 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | 2-(difluoromethyl)-6-(2-phenylacetyl)-2H-chromene-3-carboxylic acid |
| SMILES | O=C(O)C1=Cc2cc(C(=O)Cc3ccccc3)ccc2OC1C(F)F |
| InChI | InChI=1S/C19H14F2O4/c20-18(21)17-14(19(23)24)10-13-9-12(6-7-16(13)25-17)15(22)8-11-4-2-1-3-5-11/h1-7,9-10,17-18H,8H2,(H,23,24) |
| InChIKey | XPKVROOTEGMBIN-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.31 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |