C15H14ClF3O2 — CID 141318740
(2S)-7-tert-butyl-6-chloro-2-(trifluoromethyl)-2H-chromene-3-carbaldehyde (PubChem CID 141318740) has the molecular formula C15H14ClF3O2 and a molecular weight of 318.72 g/mol. Its IUPAC name is (2S)-7-tert-butyl-6-chloro-2-(trifluoromethyl)-2H-chromene-3-carbaldehyde.
| Compound Name | (2S)-7-tert-butyl-6-chloro-2-(trifluoromethyl)-2H-chromene-3-carbaldehyde |
|---|---|
| PubChem CID | 141318740 |
| Molecular Formula | C15H14ClF3O2 |
| Molecular Weight | 318.72 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | (2S)-7-tert-butyl-6-chloro-2-(trifluoromethyl)-2H-chromene-3-carbaldehyde |
| SMILES | CC(C)(C)c1cc2c(cc1Cl)C=C(C=O)[C@@H](C(F)(F)F)O2 |
| InChI | InChI=1S/C15H14ClF3O2/c1-14(2,3)10-6-12-8(5-11(10)16)4-9(7-20)13(21-12)15(17,18)19/h4-7,13H,1-3H3/t13-/m0/s1 |
| InChIKey | SCHXYARCWXHADN-ZDUSSCGKSA-N |
| XLogP | 4.54 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.72 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|