C19H17ClF3NO8 — CID 122699676
(6-nitrooxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl) 6-chloro-5,7-dimethyl-2-(trifluoromethyl)-2H-chromene-3-carboxylate (PubChem CID 122699676) has the molecular formula C19H17ClF3NO8 and a molecular weight of 479.79 g/mol. Its IUPAC name is (6-nitrooxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl) 6-chloro-5,7-dimethyl-2-(trifluoromethyl)-2H-chromene-3-carboxylate.
| Compound Name | (6-nitrooxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl) 6-chloro-5,7-dimethyl-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 122699676 |
| Molecular Formula | C19H17ClF3NO8 |
| Molecular Weight | 479.79 g/mol |
| Exact Mass | 479.06 |
| IUPAC Name | (6-nitrooxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl) 6-chloro-5,7-dimethyl-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
| SMILES | Cc1cc2c(c(C)c1Cl)C=C(C(=O)OC1COC3C(O[N+](=O)[O-])COC13)C(C(F)(F)F)O2 |
| InChI | InChI=1S/C19H17ClF3NO8/c1-7-3-11-9(8(2)14(7)20)4-10(17(30-11)19(21,22)23)18(25)31-12-5-28-16-13(32-24(26)27)6-29-15(12)16/h3-4,12-13,15-17H,5-6H2,1-2H3 |
| InChIKey | VCQMORPMESKVDU-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 106.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.79 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|