C18H21ClF3N3O6 — CID 118239246
(Z)-2-[(2S)-6-chloro-5,7-dimethyl-2-(trifluoromethyl)-2H-chromene-3-carbonyl]oxyethoxyimino-[2-hydroxyethyl(methyl)amino]-oxidoazanium (PubChem CID 118239246) has the molecular formula C18H21ClF3N3O6 and a molecular weight of 467.83 g/mol. Its IUPAC name is (Z)-2-[(2S)-6-chloro-5,7-dimethyl-2-(trifluoromethyl)-2H-chromene-3-carbonyl]oxyethoxyimino-[2-hydroxyethyl(methyl)amino]-oxidoazanium.
| Compound Name | (Z)-2-[(2S)-6-chloro-5,7-dimethyl-2-(trifluoromethyl)-2H-chromene-3-carbonyl]oxyethoxyimino-[2-hydroxyethyl(methyl)amino]-oxidoazanium |
|---|---|
| PubChem CID | 118239246 |
| Molecular Formula | C18H21ClF3N3O6 |
| Molecular Weight | 467.83 g/mol |
| Exact Mass | 467.11 |
| IUPAC Name | (Z)-2-[(2S)-6-chloro-5,7-dimethyl-2-(trifluoromethyl)-2H-chromene-3-carbonyl]oxyethoxyimino-[2-hydroxyethyl(methyl)amino]-oxidoazanium |
| SMILES | Cc1cc2c(c(C)c1Cl)C=C(C(=O)OCCO/N=[N+](\[O-])N(C)CCO)[C@@H](C(F)(F)F)O2 |
| InChI | InChI=1S/C18H21ClF3N3O6/c1-10-8-14-12(11(2)15(10)19)9-13(16(31-14)18(20,21)22)17(27)29-6-7-30-23-25(28)24(3)4-5-26/h8-9,16,26H,4-7H2,1-3H3/b25-23-/t16-/m0/s1 |
| InChIKey | FVXIIHGCYMVPRI-LDWQWDCMSA-N |
| XLogP | 2.94 |
| TPSA | 106.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.83 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|