C19H18ClF3N2O12 — CID 155182270
1-(1,3-dinitrooxypropan-2-yloxycarbonyloxy)ethyl 6-chloro-5,7-dimethyl-2-(trifluoromethyl)-2H-chromene-3-carboxylate (PubChem CID 155182270) has the molecular formula C19H18ClF3N2O12 and a molecular weight of 558.80 g/mol. Its IUPAC name is 1-(1,3-dinitrooxypropan-2-yloxycarbonyloxy)ethyl 6-chloro-5,7-dimethyl-2-(trifluoromethyl)-2H-chromene-3-carboxylate.
| Compound Name | 1-(1,3-dinitrooxypropan-2-yloxycarbonyloxy)ethyl 6-chloro-5,7-dimethyl-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 155182270 |
| Molecular Formula | C19H18ClF3N2O12 |
| Molecular Weight | 558.80 g/mol |
| Exact Mass | 558.05 |
| IUPAC Name | 1-(1,3-dinitrooxypropan-2-yloxycarbonyloxy)ethyl 6-chloro-5,7-dimethyl-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
| SMILES | Cc1cc2c(c(C)c1Cl)C=C(C(=O)OC(C)OC(=O)OC(CO[N+](=O)[O-])CO[N+](=O)[O-])C(C(F)(F)F)O2 |
| InChI | InChI=1S/C19H18ClF3N2O12/c1-8-4-14-12(9(2)15(8)20)5-13(16(37-14)19(21,22)23)17(26)34-10(3)35-18(27)36-11(6-32-24(28)29)7-33-25(30)31/h4-5,10-11,16H,6-7H2,1-3H3 |
| InChIKey | RLQSVKNHOAGOJS-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 175.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.80 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|