C17H15ClF3NO8 — CID 122699720
2-(2-nitrooxyacetyl)oxyethyl (2S)-6-chloro-5,7-dimethyl-2-(trifluoromethyl)-2H-chromene-3-carboxylate (PubChem CID 122699720) has the molecular formula C17H15ClF3NO8 and a molecular weight of 453.75 g/mol. Its IUPAC name is 2-(2-nitrooxyacetyl)oxyethyl (2S)-6-chloro-5,7-dimethyl-2-(trifluoromethyl)-2H-chromene-3-carboxylate.
| Compound Name | 2-(2-nitrooxyacetyl)oxyethyl (2S)-6-chloro-5,7-dimethyl-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 122699720 |
| Molecular Formula | C17H15ClF3NO8 |
| Molecular Weight | 453.75 g/mol |
| Exact Mass | 453.04 |
| IUPAC Name | 2-(2-nitrooxyacetyl)oxyethyl (2S)-6-chloro-5,7-dimethyl-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
| SMILES | Cc1cc2c(c(C)c1Cl)C=C(C(=O)OCCOC(=O)CO[N+](=O)[O-])[C@@H](C(F)(F)F)O2 |
| InChI | InChI=1S/C17H15ClF3NO8/c1-8-5-12-10(9(2)14(8)18)6-11(15(30-12)17(19,20)21)16(24)28-4-3-27-13(23)7-29-22(25)26/h5-6,15H,3-4,7H2,1-2H3/t15-/m0/s1 |
| InChIKey | SVOLXXJUPOVPHZ-HNNXBMFYSA-N |
| XLogP | 2.96 |
| TPSA | 114.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.75 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|