C13H9ClF3O3- — CID 154467529
6-chloro-5,7-dimethyl-2-(trifluoromethyl)-2H-chromene-3-carboxylate (PubChem CID 154467529) has the molecular formula C13H9ClF3O3- and a molecular weight of 305.66 g/mol. Its IUPAC name is 6-chloro-5,7-dimethyl-2-(trifluoromethyl)-2H-chromene-3-carboxylate.
| Compound Name | 6-chloro-5,7-dimethyl-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 154467529 |
| Molecular Formula | C13H9ClF3O3- |
| Molecular Weight | 305.66 g/mol |
| Exact Mass | 305.02 |
| IUPAC Name | 6-chloro-5,7-dimethyl-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
| SMILES | Cc1cc2c(c(C)c1Cl)C=C(C(=O)[O-])C(C(F)(F)F)O2 |
| InChI | InChI=1S/C13H10ClF3O3/c1-5-3-9-7(6(2)10(5)14)4-8(12(18)19)11(20-9)13(15,16)17/h3-4,11H,1-2H3,(H,18,19)/p-1 |
| InChIKey | UNEVTVWOSGJGLU-UHFFFAOYSA-M |
| XLogP | 2.41 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.66 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |