C14H12F8O3S — CID 137412826
6-(pentafluoro-λ6-sulfanyl)-8-propyl-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid (PubChem CID 137412826) has the molecular formula C14H12F8O3S and a molecular weight of 412.30 g/mol. Its IUPAC name is 6-(pentafluoro-λ6-sulfanyl)-8-propyl-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid.
| Compound Name | 6-(pentafluoro-λ6-sulfanyl)-8-propyl-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
|---|---|
| PubChem CID | 137412826 |
| Molecular Formula | C14H12F8O3S |
| Molecular Weight | 412.30 g/mol |
| Exact Mass | 412.04 |
| IUPAC Name | 6-(pentafluoro-λ6-sulfanyl)-8-propyl-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
| SMILES | CCCc1cc(S(F)(F)(F)(F)F)cc2c1OC(C(F)(F)F)C(C(=O)O)=C2 |
| InChI | InChI=1S/C14H12F8O3S/c1-2-3-7-4-9(26(18,19,20,21)22)5-8-6-10(13(23)24)12(14(15,16)17)25-11(7)8/h4-6,12H,2-3H2,1H3,(H,23,24) |
| InChIKey | DHZKWLKOBNXRLI-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.30 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |