About 6,8-dibromo-2-(1,2-difluoropropan-2-yl)-2H-chromene-3-carboxylic acid
6,8-dibromo-2-(1,2-difluoropropan-2-yl)-2H-chromene-3-carboxylic acid (PubChem CID 142958993) has the molecular formula C13H10Br2F2O3
and a molecular weight of 412.02 g/mol. Its IUPAC name is 6,8-dibromo-2-(1,2-difluoropropan-2-yl)-2H-chromene-3-carboxylic acid.
Molecular Properties
| Compound Name | 6,8-dibromo-2-(1,2-difluoropropan-2-yl)-2H-chromene-3-carboxylic acid |
| PubChem CID | 142958993 |
| Molecular Formula | C13H10Br2F2O3 |
| Molecular Weight | 412.02 g/mol |
| Exact Mass | 409.90 |
| IUPAC Name | 6,8-dibromo-2-(1,2-difluoropropan-2-yl)-2H-chromene-3-carboxylic acid |
| SMILES | CC(F)(CF)C1Oc2c(Br)cc(Br)cc2C=C1C(=O)O |
| InChI | InChI=1S/C13H10Br2F2O3/c1-13(17,5-16)11-8(12(18)19)3-6-2-7(14)4-9(15)10(6)20-11/h2-4,11H,5H2,1H3,(H,18,19) |
| InChIKey | AZFFCSZPMJMNOP-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.02 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6,8-dibromo-2-(1,2-difluoropropan-2-yl)-2H-chromene-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,8-dibromo-2-(1,2-difluoropropan-2-yl)-2H-chromene-3-carboxylic acid?
The IUPAC name of 6,8-dibromo-2-(1,2-difluoropropan-2-yl)-2H-chromene-3-carboxylic acid (CID 142958993) is 6,8-dibromo-2-(1,2-difluoropropan-2-yl)-2H-chromene-3-carboxylic acid.
What is the SMILES notation for 6,8-dibromo-2-(1,2-difluoropropan-2-yl)-2H-chromene-3-carboxylic acid?
The canonical SMILES for 6,8-dibromo-2-(1,2-difluoropropan-2-yl)-2H-chromene-3-carboxylic acid is CC(F)(CF)C1Oc2c(Br)cc(Br)cc2C=C1C(=O)O.
What is the InChIKey of 6,8-dibromo-2-(1,2-difluoropropan-2-yl)-2H-chromene-3-carboxylic acid?
The InChIKey is AZFFCSZPMJMNOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10Br2F2O3/c1-13(17,5-16)11-8(12(18)19)3-6-2-7(14)4-9(15)10(6)20-11/h2-4,11H,5H2,1H3,(H,18,19).
What are the key properties of 6,8-dibromo-2-(1,2-difluoropropan-2-yl)-2H-chromene-3-carboxylic acid?
6,8-dibromo-2-(1,2-difluoropropan-2-yl)-2H-chromene-3-carboxylic acid has a molecular weight of 412.02 g/mol, XLogP of 4.14, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,8-dibromo-2-(1,2-difluoropropan-2-yl)-2H-chromene-3-carboxylic acid is sourced from PubChem (CID 142958993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).