C18H19ClF3O4- — CID 58934849
6-chloro-7-(2-ethylbutoxy)-8-methyl-2-(trifluoromethyl)-2H-chromene-3-carboxylate (PubChem CID 58934849) has the molecular formula C18H19ClF3O4- and a molecular weight of 391.79 g/mol. Its IUPAC name is 6-chloro-7-(2-ethylbutoxy)-8-methyl-2-(trifluoromethyl)-2H-chromene-3-carboxylate.
| Compound Name | 6-chloro-7-(2-ethylbutoxy)-8-methyl-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 58934849 |
| Molecular Formula | C18H19ClF3O4- |
| Molecular Weight | 391.79 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | 6-chloro-7-(2-ethylbutoxy)-8-methyl-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
| SMILES | CCC(CC)COc1c(Cl)cc2c(c1C)OC(C(F)(F)F)C(C(=O)[O-])=C2 |
| InChI | InChI=1S/C18H20ClF3O4/c1-4-10(5-2)8-25-15-9(3)14-11(7-13(15)19)6-12(17(23)24)16(26-14)18(20,21)22/h6-7,10,16H,4-5,8H2,1-3H3,(H,23,24)/p-1 |
| InChIKey | NGFRFQNUVNOMKR-UHFFFAOYSA-M |
| XLogP | 3.92 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.79 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |