C18H20F3IO4 — CID 89341843
7-(2,2-dimethylpropoxy)-6-(iodomethyl)-8-methyl-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid (PubChem CID 89341843) has the molecular formula C18H20F3IO4 and a molecular weight of 484.25 g/mol. Its IUPAC name is 7-(2,2-dimethylpropoxy)-6-(iodomethyl)-8-methyl-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid.
| Compound Name | 7-(2,2-dimethylpropoxy)-6-(iodomethyl)-8-methyl-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
|---|---|
| PubChem CID | 89341843 |
| Molecular Formula | C18H20F3IO4 |
| Molecular Weight | 484.25 g/mol |
| Exact Mass | 484.04 |
| IUPAC Name | 7-(2,2-dimethylpropoxy)-6-(iodomethyl)-8-methyl-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
| SMILES | Cc1c2c(cc(CI)c1OCC(C)(C)C)C=C(C(=O)O)C(C(F)(F)F)O2 |
| InChI | InChI=1S/C18H20F3IO4/c1-9-13(25-8-17(2,3)4)11(7-22)5-10-6-12(16(23)24)15(18(19,20)21)26-14(9)10/h5-6,15H,7-8H2,1-4H3,(H,23,24) |
| InChIKey | WXIDVWQGFQPVIJ-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.25 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|