C18H21F3O4 — CID 174486787
7-hexoxy-8-methyl-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid (PubChem CID 174486787) has the molecular formula C18H21F3O4 and a molecular weight of 358.36 g/mol. Its IUPAC name is 7-hexoxy-8-methyl-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid.
| Compound Name | 7-hexoxy-8-methyl-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
|---|---|
| PubChem CID | 174486787 |
| Molecular Formula | C18H21F3O4 |
| Molecular Weight | 358.36 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 7-hexoxy-8-methyl-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
| SMILES | CCCCCCOc1ccc2c(c1C)OC(C(F)(F)F)C(C(=O)O)=C2 |
| InChI | InChI=1S/C18H21F3O4/c1-3-4-5-6-9-24-14-8-7-12-10-13(17(22)23)16(18(19,20)21)25-15(12)11(14)2/h7-8,10,16H,3-6,9H2,1-2H3,(H,22,23) |
| InChIKey | GVJZJZSALBYTPC-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.36 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|