C14H12ClF3O4 — CID 11404950
5-chloro-8-propoxy-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid (PubChem CID 11404950) has the molecular formula C14H12ClF3O4 and a molecular weight of 336.69 g/mol. Its IUPAC name is 5-chloro-8-propoxy-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid.
| Compound Name | 5-chloro-8-propoxy-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
|---|---|
| PubChem CID | 11404950 |
| Molecular Formula | C14H12ClF3O4 |
| Molecular Weight | 336.69 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | 5-chloro-8-propoxy-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
| SMILES | CCCOc1ccc(Cl)c2c1OC(C(F)(F)F)C(C(=O)O)=C2 |
| InChI | InChI=1S/C14H12ClF3O4/c1-2-5-21-10-4-3-9(15)7-6-8(13(19)20)12(14(16,17)18)22-11(7)10/h3-4,6,12H,2,5H2,1H3,(H,19,20) |
| InChIKey | VZJKMDJGGAPBEY-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.69 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |