C13H8Cl3F3O4 — CID 58934820
5,6,7-trichloro-8-ethoxy-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid (PubChem CID 58934820) has the molecular formula C13H8Cl3F3O4 and a molecular weight of 391.56 g/mol. Its IUPAC name is 5,6,7-trichloro-8-ethoxy-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid.
| Compound Name | 5,6,7-trichloro-8-ethoxy-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
|---|---|
| PubChem CID | 58934820 |
| Molecular Formula | C13H8Cl3F3O4 |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 389.94 |
| IUPAC Name | 5,6,7-trichloro-8-ethoxy-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
| SMILES | CCOc1c(Cl)c(Cl)c(Cl)c2c1OC(C(F)(F)F)C(C(=O)O)=C2 |
| InChI | InChI=1S/C13H8Cl3F3O4/c1-2-22-10-8(16)7(15)6(14)4-3-5(12(20)21)11(13(17,18)19)23-9(4)10/h3,11H,2H2,1H3,(H,20,21) |
| InChIKey | HAFAQPWSXNLJMY-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|