C14H10Cl3F3O4 — CID 58934934
5,6,7-trichloro-8-propoxy-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid (PubChem CID 58934934) has the molecular formula C14H10Cl3F3O4 and a molecular weight of 405.58 g/mol. Its IUPAC name is 5,6,7-trichloro-8-propoxy-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid.
| Compound Name | 5,6,7-trichloro-8-propoxy-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
|---|---|
| PubChem CID | 58934934 |
| Molecular Formula | C14H10Cl3F3O4 |
| Molecular Weight | 405.58 g/mol |
| Exact Mass | 403.96 |
| IUPAC Name | 5,6,7-trichloro-8-propoxy-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
| SMILES | CCCOc1c(Cl)c(Cl)c(Cl)c2c1OC(C(F)(F)F)C(C(=O)O)=C2 |
| InChI | InChI=1S/C14H10Cl3F3O4/c1-2-3-23-11-9(17)8(16)7(15)5-4-6(13(21)22)12(14(18,19)20)24-10(5)11/h4,12H,2-3H2,1H3,(H,21,22) |
| InChIKey | SOJIGUZDGPUPOH-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.58 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|