C21H21F3O6 — CID 159544481
2-ethoxyphenol;8-ethoxy-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid (PubChem CID 159544481) has the molecular formula C21H21F3O6 and a molecular weight of 426.39 g/mol. Its IUPAC name is 2-ethoxyphenol;8-ethoxy-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid.
| Compound Name | 2-ethoxyphenol;8-ethoxy-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
|---|---|
| PubChem CID | 159544481 |
| Molecular Formula | C21H21F3O6 |
| Molecular Weight | 426.39 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | 2-ethoxyphenol;8-ethoxy-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
| SMILES | CCOc1cccc2c1OC(C(F)(F)F)C(C(=O)O)=C2.CCOc1ccccc1O |
| InChI | InChI=1S/C13H11F3O4.C8H10O2/c1-2-19-9-5-3-4-7-6-8(12(17)18)11(13(14,15)16)20-10(7)9;1-2-10-8-6-4-3-5-7(8)9/h3-6,11H,2H2,1H3,(H,17,18);3-6,9H,2H2,1H3 |
| InChIKey | MEPWVVMEACOYIH-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.39 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |