C22H15F3O4 — CID 11211735
8-methyl-7-naphthalen-2-yloxy-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid (PubChem CID 11211735) has the molecular formula C22H15F3O4 and a molecular weight of 400.35 g/mol. Its IUPAC name is 8-methyl-7-naphthalen-2-yloxy-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid.
| Compound Name | 8-methyl-7-naphthalen-2-yloxy-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
|---|---|
| PubChem CID | 11211735 |
| Molecular Formula | C22H15F3O4 |
| Molecular Weight | 400.35 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | 8-methyl-7-naphthalen-2-yloxy-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
| SMILES | Cc1c(Oc2ccc3ccccc3c2)ccc2c1OC(C(F)(F)F)C(C(=O)O)=C2 |
| InChI | InChI=1S/C22H15F3O4/c1-12-18(28-16-8-6-13-4-2-3-5-14(13)10-16)9-7-15-11-17(21(26)27)20(22(23,24)25)29-19(12)15/h2-11,20H,1H3,(H,26,27) |
| InChIKey | SIATWDVLMKZXFS-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.35 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |