C17H9F4NO6 — CID 58934550
7-(2-fluoro-4-nitrophenoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid (PubChem CID 58934550) has the molecular formula C17H9F4NO6 and a molecular weight of 399.25 g/mol. Its IUPAC name is 7-(2-fluoro-4-nitrophenoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid.
| Compound Name | 7-(2-fluoro-4-nitrophenoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
|---|---|
| PubChem CID | 58934550 |
| Molecular Formula | C17H9F4NO6 |
| Molecular Weight | 399.25 g/mol |
| Exact Mass | 399.04 |
| IUPAC Name | 7-(2-fluoro-4-nitrophenoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
| SMILES | O=C(O)C1=Cc2ccc(Oc3ccc([N+](=O)[O-])cc3F)cc2OC1C(F)(F)F |
| InChI | InChI=1S/C17H9F4NO6/c18-12-6-9(22(25)26)2-4-13(12)27-10-3-1-8-5-11(16(23)24)15(17(19,20)21)28-14(8)7-10/h1-7,15H,(H,23,24) |
| InChIKey | FFRRRXBBEVCGPI-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 98.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.25 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|