C18H12F4O3 — CID 150577967
8-(3-fluoro-4-methylphenyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid (PubChem CID 150577967) has the molecular formula C18H12F4O3 and a molecular weight of 352.28 g/mol. Its IUPAC name is 8-(3-fluoro-4-methylphenyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid.
| Compound Name | 8-(3-fluoro-4-methylphenyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
|---|---|
| PubChem CID | 150577967 |
| Molecular Formula | C18H12F4O3 |
| Molecular Weight | 352.28 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | 8-(3-fluoro-4-methylphenyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
| SMILES | Cc1ccc(-c2cccc3c2OC(C(F)(F)F)C(C(=O)O)=C3)cc1F |
| InChI | InChI=1S/C18H12F4O3/c1-9-5-6-10(8-14(9)19)12-4-2-3-11-7-13(17(23)24)16(18(20,21)22)25-15(11)12/h2-8,16H,1H3,(H,23,24) |
| InChIKey | INFKVAZIADTDII-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.28 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |