C15H12Cl3F3O3 — CID 11153917
8-butyl-5,6,7-trichloro-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid (PubChem CID 11153917) has the molecular formula C15H12Cl3F3O3 and a molecular weight of 403.61 g/mol. Its IUPAC name is 8-butyl-5,6,7-trichloro-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid.
| Compound Name | 8-butyl-5,6,7-trichloro-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
|---|---|
| PubChem CID | 11153917 |
| Molecular Formula | C15H12Cl3F3O3 |
| Molecular Weight | 403.61 g/mol |
| Exact Mass | 401.98 |
| IUPAC Name | 8-butyl-5,6,7-trichloro-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
| SMILES | CCCCc1c(Cl)c(Cl)c(Cl)c2c1OC(C(F)(F)F)C(C(=O)O)=C2 |
| InChI | InChI=1S/C15H12Cl3F3O3/c1-2-3-4-6-9(16)11(18)10(17)7-5-8(14(22)23)13(15(19,20)21)24-12(6)7/h5,13H,2-4H2,1H3,(H,22,23) |
| InChIKey | YYWAGWHJGOSZDO-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.61 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|