C16H9ClF3O3S- — CID 58934492
6-chloro-7-(thiophen-2-ylmethyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylate (PubChem CID 58934492) has the molecular formula C16H9ClF3O3S- and a molecular weight of 373.76 g/mol. Its IUPAC name is 6-chloro-7-(thiophen-2-ylmethyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylate.
| Compound Name | 6-chloro-7-(thiophen-2-ylmethyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 58934492 |
| Molecular Formula | C16H9ClF3O3S- |
| Molecular Weight | 373.76 g/mol |
| Exact Mass | 372.99 |
| IUPAC Name | 6-chloro-7-(thiophen-2-ylmethyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
| SMILES | O=C([O-])C1=Cc2cc(Cl)c(Cc3cccs3)cc2OC1C(F)(F)F |
| InChI | InChI=1S/C16H10ClF3O3S/c17-12-6-9-5-11(15(21)22)14(16(18,19)20)23-13(9)7-8(12)4-10-2-1-3-24-10/h1-3,5-7,14H,4H2,(H,21,22)/p-1 |
| InChIKey | ALEXEMNJKAWNHO-UHFFFAOYSA-M |
| XLogP | 3.45 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.76 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |