C12H10F3NOS2 — CID 62490776
2,2,2-trifluoro-N,N-bis(thiophen-2-ylmethyl)acetamide (PubChem CID 62490776) has the molecular formula C12H10F3NOS2 and a molecular weight of 305.35 g/mol. Its IUPAC name is 2,2,2-trifluoro-N,N-bis(thiophen-2-ylmethyl)acetamide.
| Compound Name | 2,2,2-trifluoro-N,N-bis(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 62490776 |
| Molecular Formula | C12H10F3NOS2 |
| Molecular Weight | 305.35 g/mol |
| Exact Mass | 305.02 |
| IUPAC Name | 2,2,2-trifluoro-N,N-bis(thiophen-2-ylmethyl)acetamide |
| SMILES | O=C(N(Cc1cccs1)Cc1cccs1)C(F)(F)F |
| InChI | InChI=1S/C12H10F3NOS2/c13-12(14,15)11(17)16(7-9-3-1-5-18-9)8-10-4-2-6-19-10/h1-6H,7-8H2 |
| InChIKey | TWQOHWKRANNCEX-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.35 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |