C15H13ClF3N3O4S — CID 18691483
N-[2-(2-amino-5-chloro-3-nitrophenoxy)ethyl]-2,2,2-trifluoro-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 18691483) has the molecular formula C15H13ClF3N3O4S and a molecular weight of 423.80 g/mol. Its IUPAC name is N-[2-(2-amino-5-chloro-3-nitrophenoxy)ethyl]-2,2,2-trifluoro-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | N-[2-(2-amino-5-chloro-3-nitrophenoxy)ethyl]-2,2,2-trifluoro-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 18691483 |
| Molecular Formula | C15H13ClF3N3O4S |
| Molecular Weight | 423.80 g/mol |
| Exact Mass | 423.03 |
| IUPAC Name | N-[2-(2-amino-5-chloro-3-nitrophenoxy)ethyl]-2,2,2-trifluoro-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | Nc1c(OCCN(Cc2cccs2)C(=O)C(F)(F)F)cc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H13ClF3N3O4S/c16-9-6-11(22(24)25)13(20)12(7-9)26-4-3-21(14(23)15(17,18)19)8-10-2-1-5-27-10/h1-2,5-7H,3-4,8,20H2 |
| InChIKey | LZJAWBJIDRGILP-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 98.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.80 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|