C16H10F3NO2S — CID 2465989
(4E)-4-[(5-methylthiophen-2-yl)methylidene]-2-[4-(trifluoromethyl)phenyl]-1,3-oxazol-5-one (PubChem CID 2465989) has the molecular formula C16H10F3NO2S and a molecular weight of 337.32 g/mol. Its IUPAC name is (4E)-4-[(5-methylthiophen-2-yl)methylidene]-2-[4-(trifluoromethyl)phenyl]-1,3-oxazol-5-one.
| Compound Name | (4E)-4-[(5-methylthiophen-2-yl)methylidene]-2-[4-(trifluoromethyl)phenyl]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 2465989 |
| Molecular Formula | C16H10F3NO2S |
| Molecular Weight | 337.32 g/mol |
| Exact Mass | 337.04 |
| IUPAC Name | (4E)-4-[(5-methylthiophen-2-yl)methylidene]-2-[4-(trifluoromethyl)phenyl]-1,3-oxazol-5-one |
| SMILES | Cc1ccc(/C=C2/N=C(c3ccc(C(F)(F)F)cc3)OC2=O)s1 |
| InChI | InChI=1S/C16H10F3NO2S/c1-9-2-7-12(23-9)8-13-15(21)22-14(20-13)10-3-5-11(6-4-10)16(17,18)19/h2-8H,1H3/b13-8+ |
| InChIKey | AFFKZZSDBLWCBK-MDWZMJQESA-N |
| XLogP | 4.42 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.32 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|