C20H10N2O2S3 — CID 59140854
2-[5-(4-sulfanylidene-3,1-benzoxazin-2-yl)thiophen-2-yl]-3,1-benzoxazine-4-thione (PubChem CID 59140854) has the molecular formula C20H10N2O2S3 and a molecular weight of 406.51 g/mol. Its IUPAC name is 2-[5-(4-sulfanylidene-3,1-benzoxazin-2-yl)thiophen-2-yl]-3,1-benzoxazine-4-thione.
| Compound Name | 2-[5-(4-sulfanylidene-3,1-benzoxazin-2-yl)thiophen-2-yl]-3,1-benzoxazine-4-thione |
|---|---|
| PubChem CID | 59140854 |
| Molecular Formula | C20H10N2O2S3 |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 405.99 |
| IUPAC Name | 2-[5-(4-sulfanylidene-3,1-benzoxazin-2-yl)thiophen-2-yl]-3,1-benzoxazine-4-thione |
| SMILES | S=c1oc(-c2ccc(-c3nc4ccccc4c(=S)o3)s2)nc2ccccc12 |
| InChI | InChI=1S/C20H10N2O2S3/c25-19-11-5-1-3-7-13(11)21-17(23-19)15-9-10-16(27-15)18-22-14-8-4-2-6-12(14)20(26)24-18/h1-10H |
| InChIKey | AOAJLSSCSJBTPI-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 52.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|