C22H26N2O2S2Sn — CID 10554282
bis(1,3-benzoxazol-2-ylsulfanyl)-dibutylstannane (PubChem CID 10554282) has the molecular formula C22H26N2O2S2Sn and a molecular weight of 533.31 g/mol. Its IUPAC name is bis(1,3-benzoxazol-2-ylsulfanyl)-dibutylstannane.
| Compound Name | bis(1,3-benzoxazol-2-ylsulfanyl)-dibutylstannane |
|---|---|
| PubChem CID | 10554282 |
| Molecular Formula | C22H26N2O2S2Sn |
| Molecular Weight | 533.31 g/mol |
| Exact Mass | 534.05 |
| IUPAC Name | bis(1,3-benzoxazol-2-ylsulfanyl)-dibutylstannane |
| SMILES | CCCC[Sn](CCCC)(Sc1nc2ccccc2o1)Sc1nc2ccccc2o1 |
| InChI | InChI=1S/2C7H5NOS.2C4H9.Sn/c2*10-7-8-5-3-1-2-4-6(5)9-7;2*1-3-4-2;/h2*1-4H,(H,8,10);2*1,3-4H2,2H3;/q;;;;+2/p-2 |
| InChIKey | POHGWEYOFNRNOX-UHFFFAOYSA-L |
| XLogP | 7.90 |
| TPSA | 52.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.31 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |