C18H15N3O2S — CID 9006339
2-[3-(3-phenyl-1,2,4-oxadiazol-5-yl)propylsulfanyl]-1,3-benzoxazole (PubChem CID 9006339) has the molecular formula C18H15N3O2S and a molecular weight of 337.40 g/mol. Its IUPAC name is 2-[3-(3-phenyl-1,2,4-oxadiazol-5-yl)propylsulfanyl]-1,3-benzoxazole.
| Compound Name | 2-[3-(3-phenyl-1,2,4-oxadiazol-5-yl)propylsulfanyl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 9006339 |
| Molecular Formula | C18H15N3O2S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | 2-[3-(3-phenyl-1,2,4-oxadiazol-5-yl)propylsulfanyl]-1,3-benzoxazole |
| SMILES | c1ccc(-c2noc(CCCSc3nc4ccccc4o3)n2)cc1 |
| InChI | InChI=1S/C18H15N3O2S/c1-2-7-13(8-3-1)17-20-16(23-21-17)11-6-12-24-18-19-14-9-4-5-10-15(14)22-18/h1-5,7-10H,6,11-12H2 |
| InChIKey | HQONSUQXCAWWMJ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 64.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|