C13H15NO4S — CID 63098237
4-(1,3-benzoxazol-2-ylsulfanyl)-2-ethoxybutanoic acid (PubChem CID 63098237) has the molecular formula C13H15NO4S and a molecular weight of 281.33 g/mol. Its IUPAC name is 4-(1,3-benzoxazol-2-ylsulfanyl)-2-ethoxybutanoic acid.
| Compound Name | 4-(1,3-benzoxazol-2-ylsulfanyl)-2-ethoxybutanoic acid |
|---|---|
| PubChem CID | 63098237 |
| Molecular Formula | C13H15NO4S |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | 4-(1,3-benzoxazol-2-ylsulfanyl)-2-ethoxybutanoic acid |
| SMILES | CCOC(CCSc1nc2ccccc2o1)C(=O)O |
| InChI | InChI=1S/C13H15NO4S/c1-2-17-11(12(15)16)7-8-19-13-14-9-5-3-4-6-10(9)18-13/h3-6,11H,2,7-8H2,1H3,(H,15,16) |
| InChIKey | PEZXZQUGRDNUFB-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |