4-(1,3-benzoxazol-2-ylsulfanyl)-2-ethoxybutanoic acid

C13H15NO4S — CID 63098237

IUPAC4-(1,3-benzoxazol-2-ylsulfanyl)-2-ethoxybutanoic acid
SMILESCCOC(CCSc1nc2ccccc2o1)C(=O)O
InChIInChI=1S/C13H15NO4S/c1-2-17-11(12(15)16)7-8-19-13-14-9-5-3-4-6-10(9)18-13/h3-6,11H,2,7-8H2,1H3,(H,15,16)
InChIKeyPEZXZQUGRDNUFB-UHFFFAOYSA-N
MW281.33 g/mol
LogP2.80
Rot. Bonds7

About 4-(1,3-benzoxazol-2-ylsulfanyl)-2-ethoxybutanoic acid

4-(1,3-benzoxazol-2-ylsulfanyl)-2-ethoxybutanoic acid (PubChem CID 63098237) has the molecular formula C13H15NO4S and a molecular weight of 281.33 g/mol. Its IUPAC name is 4-(1,3-benzoxazol-2-ylsulfanyl)-2-ethoxybutanoic acid.

Molecular Properties

Compound Name4-(1,3-benzoxazol-2-ylsulfanyl)-2-ethoxybutanoic acid
PubChem CID63098237
Molecular FormulaC13H15NO4S
Molecular Weight281.33 g/mol
Exact Mass281.07
IUPAC Name4-(1,3-benzoxazol-2-ylsulfanyl)-2-ethoxybutanoic acid
SMILESCCOC(CCSc1nc2ccccc2o1)C(=O)O
InChIInChI=1S/C13H15NO4S/c1-2-17-11(12(15)16)7-8-19-13-14-9-5-3-4-6-10(9)18-13/h3-6,11H,2,7-8H2,1H3,(H,15,16)
InChIKeyPEZXZQUGRDNUFB-UHFFFAOYSA-N
XLogP2.80
TPSA72.56 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds7
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500281.33
LogP ≤ 52.80
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 4-(1,3-benzoxazol-2-ylsulfanyl)-2-ethoxybutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(1,3-benzoxazol-2-ylsulfanyl)-2-ethoxybutanoic acid?
The IUPAC name of 4-(1,3-benzoxazol-2-ylsulfanyl)-2-ethoxybutanoic acid (CID 63098237) is 4-(1,3-benzoxazol-2-ylsulfanyl)-2-ethoxybutanoic acid.
What is the SMILES notation for 4-(1,3-benzoxazol-2-ylsulfanyl)-2-ethoxybutanoic acid?
The canonical SMILES for 4-(1,3-benzoxazol-2-ylsulfanyl)-2-ethoxybutanoic acid is CCOC(CCSc1nc2ccccc2o1)C(=O)O.
What is the InChIKey of 4-(1,3-benzoxazol-2-ylsulfanyl)-2-ethoxybutanoic acid?
The InChIKey is PEZXZQUGRDNUFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO4S/c1-2-17-11(12(15)16)7-8-19-13-14-9-5-3-4-6-10(9)18-13/h3-6,11H,2,7-8H2,1H3,(H,15,16).
What are the key properties of 4-(1,3-benzoxazol-2-ylsulfanyl)-2-ethoxybutanoic acid?
4-(1,3-benzoxazol-2-ylsulfanyl)-2-ethoxybutanoic acid has a molecular weight of 281.33 g/mol, XLogP of 2.80, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-benzoxazol-2-ylsulfanyl)-2-ethoxybutanoic acid is sourced from PubChem (CID 63098237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).