C16H19NO5S — CID 70495241
3-(1,3-benzoxazol-2-ylsulfanylmethyl)-2,2-diethylbutanedioic acid (PubChem CID 70495241) has the molecular formula C16H19NO5S and a molecular weight of 337.40 g/mol. Its IUPAC name is 3-(1,3-benzoxazol-2-ylsulfanylmethyl)-2,2-diethylbutanedioic acid.
| Compound Name | 3-(1,3-benzoxazol-2-ylsulfanylmethyl)-2,2-diethylbutanedioic acid |
|---|---|
| PubChem CID | 70495241 |
| Molecular Formula | C16H19NO5S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | 3-(1,3-benzoxazol-2-ylsulfanylmethyl)-2,2-diethylbutanedioic acid |
| SMILES | CCC(CC)(C(=O)O)C(CSc1nc2ccccc2o1)C(=O)O |
| InChI | InChI=1S/C16H19NO5S/c1-3-16(4-2,14(20)21)10(13(18)19)9-23-15-17-11-7-5-6-8-12(11)22-15/h5-8,10H,3-4,9H2,1-2H3,(H,18,19)(H,20,21) |
| InChIKey | CAAVPCRBPHQEPT-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |