C22H25FN4O2S — CID 86901787
2-(1,3-benzoxazol-2-ylsulfanyl)-N-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]acetamide (PubChem CID 86901787) has the molecular formula C22H25FN4O2S and a molecular weight of 428.53 g/mol. Its IUPAC name is 2-(1,3-benzoxazol-2-ylsulfanyl)-N-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]acetamide.
| Compound Name | 2-(1,3-benzoxazol-2-ylsulfanyl)-N-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]acetamide |
|---|---|
| PubChem CID | 86901787 |
| Molecular Formula | C22H25FN4O2S |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | 2-(1,3-benzoxazol-2-ylsulfanyl)-N-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]acetamide |
| SMILES | O=C(CSc1nc2ccccc2o1)NCCCN1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C22H25FN4O2S/c23-17-6-1-3-8-19(17)27-14-12-26(13-15-27)11-5-10-24-21(28)16-30-22-25-18-7-2-4-9-20(18)29-22/h1-4,6-9H,5,10-16H2,(H,24,28) |
| InChIKey | XHLGMXCLALUFME-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 61.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|