C15H14FN3O4 — CID 9088554
4-acetyl-N'-[2-(4-fluorophenoxy)acetyl]-1H-pyrrole-2-carbohydrazide (PubChem CID 9088554) has the molecular formula C15H14FN3O4 and a molecular weight of 319.29 g/mol. Its IUPAC name is 4-acetyl-N'-[2-(4-fluorophenoxy)acetyl]-1H-pyrrole-2-carbohydrazide.
| Compound Name | 4-acetyl-N'-[2-(4-fluorophenoxy)acetyl]-1H-pyrrole-2-carbohydrazide |
|---|---|
| PubChem CID | 9088554 |
| Molecular Formula | C15H14FN3O4 |
| Molecular Weight | 319.29 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | 4-acetyl-N'-[2-(4-fluorophenoxy)acetyl]-1H-pyrrole-2-carbohydrazide |
| SMILES | CC(=O)c1c[nH]c(C(=O)NNC(=O)COc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C15H14FN3O4/c1-9(20)10-6-13(17-7-10)15(22)19-18-14(21)8-23-12-4-2-11(16)3-5-12/h2-7,17H,8H2,1H3,(H,18,21)(H,19,22) |
| InChIKey | NWGGOGJIVBOTIY-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 100.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.29 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|