C21H30Cl2N2O3S — CID 55408233
2,4-dichloro-N-[1-(3-cyclohexyloxypropylamino)-4-methylsulfanyl-1-oxobutan-2-yl]benzamide (PubChem CID 55408233) has the molecular formula C21H30Cl2N2O3S and a molecular weight of 461.46 g/mol. Its IUPAC name is 2,4-dichloro-N-[1-(3-cyclohexyloxypropylamino)-4-methylsulfanyl-1-oxobutan-2-yl]benzamide.
| Compound Name | 2,4-dichloro-N-[1-(3-cyclohexyloxypropylamino)-4-methylsulfanyl-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 55408233 |
| Molecular Formula | C21H30Cl2N2O3S |
| Molecular Weight | 461.46 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | 2,4-dichloro-N-[1-(3-cyclohexyloxypropylamino)-4-methylsulfanyl-1-oxobutan-2-yl]benzamide |
| SMILES | CSCCC(NC(=O)c1ccc(Cl)cc1Cl)C(=O)NCCCOC1CCCCC1 |
| InChI | InChI=1S/C21H30Cl2N2O3S/c1-29-13-10-19(25-20(26)17-9-8-15(22)14-18(17)23)21(27)24-11-5-12-28-16-6-3-2-4-7-16/h8-9,14,16,19H,2-7,10-13H2,1H3,(H,24,27)(H,25,26) |
| InChIKey | BJPTZQCSFNSEIR-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.46 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|