C25H27N3O5S — CID 41138290
N-[(2S)-1-(4-benzylsulfonylpiperazin-1-yl)-1-oxo-3-phenylpropan-2-yl]furan-2-carboxamide (PubChem CID 41138290) has the molecular formula C25H27N3O5S and a molecular weight of 481.57 g/mol. Its IUPAC name is N-[(2S)-1-(4-benzylsulfonylpiperazin-1-yl)-1-oxo-3-phenylpropan-2-yl]furan-2-carboxamide.
| Compound Name | N-[(2S)-1-(4-benzylsulfonylpiperazin-1-yl)-1-oxo-3-phenylpropan-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 41138290 |
| Molecular Formula | C25H27N3O5S |
| Molecular Weight | 481.57 g/mol |
| Exact Mass | 481.17 |
| IUPAC Name | N-[(2S)-1-(4-benzylsulfonylpiperazin-1-yl)-1-oxo-3-phenylpropan-2-yl]furan-2-carboxamide |
| SMILES | O=C(N[C@@H](Cc1ccccc1)C(=O)N1CCN(S(=O)(=O)Cc2ccccc2)CC1)c1ccco1 |
| InChI | InChI=1S/C25H27N3O5S/c29-24(23-12-7-17-33-23)26-22(18-20-8-3-1-4-9-20)25(30)27-13-15-28(16-14-27)34(31,32)19-21-10-5-2-6-11-21/h1-12,17,22H,13-16,18-19H2,(H,26,29)/t22-/m0/s1 |
| InChIKey | QIFSUHNBNKHPOQ-QFIPXVFZSA-N |
| XLogP | 2.29 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.57 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |