C26H29N3O4 — CID 55918145
N-[1-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]-1-oxo-3-phenylpropan-2-yl]furan-2-carboxamide (PubChem CID 55918145) has the molecular formula C26H29N3O4 and a molecular weight of 447.54 g/mol. Its IUPAC name is N-[1-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]-1-oxo-3-phenylpropan-2-yl]furan-2-carboxamide.
| Compound Name | N-[1-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]-1-oxo-3-phenylpropan-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 55918145 |
| Molecular Formula | C26H29N3O4 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | N-[1-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]-1-oxo-3-phenylpropan-2-yl]furan-2-carboxamide |
| SMILES | COc1ccc(N2CCCN(C(=O)C(Cc3ccccc3)NC(=O)c3ccco3)CC2)cc1 |
| InChI | InChI=1S/C26H29N3O4/c1-32-22-12-10-21(11-13-22)28-14-6-15-29(17-16-28)26(31)23(19-20-7-3-2-4-8-20)27-25(30)24-9-5-18-33-24/h2-5,7-13,18,23H,6,14-17,19H2,1H3,(H,27,30) |
| InChIKey | XSUGHHPLINBLLD-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 75.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|